About 8-bromo-1,6-naphthyridine-2-carbonyl chloride
8-bromo-1,6-naphthyridine-2-carbonyl chloride (PubChem CID 58979587) has the molecular formula C9H4BrClN2O
and a molecular weight of 271.50 g/mol. Its IUPAC name is 8-bromo-1,6-naphthyridine-2-carbonyl chloride.
Molecular Properties
| Compound Name | 8-bromo-1,6-naphthyridine-2-carbonyl chloride |
| PubChem CID | 58979587 |
| Molecular Formula | C9H4BrClN2O |
| Molecular Weight | 271.50 g/mol |
| Exact Mass | 269.92 |
| IUPAC Name | 8-bromo-1,6-naphthyridine-2-carbonyl chloride |
| SMILES | O=C(Cl)c1ccc2cncc(Br)c2n1 |
| InChI | InChI=1S/C9H4BrClN2O/c10-6-4-12-3-5-1-2-7(9(11)14)13-8(5)6/h1-4H |
| InChIKey | BOMZZNCLHMADBS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 8-bromo-1,6-naphthyridine-2-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-1,6-naphthyridine-2-carbonyl chloride?
The IUPAC name of 8-bromo-1,6-naphthyridine-2-carbonyl chloride (CID 58979587) is 8-bromo-1,6-naphthyridine-2-carbonyl chloride.
What is the SMILES notation for 8-bromo-1,6-naphthyridine-2-carbonyl chloride?
The canonical SMILES for 8-bromo-1,6-naphthyridine-2-carbonyl chloride is O=C(Cl)c1ccc2cncc(Br)c2n1.
What is the InChIKey of 8-bromo-1,6-naphthyridine-2-carbonyl chloride?
The InChIKey is BOMZZNCLHMADBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4BrClN2O/c10-6-4-12-3-5-1-2-7(9(11)14)13-8(5)6/h1-4H.
What are the key properties of 8-bromo-1,6-naphthyridine-2-carbonyl chloride?
8-bromo-1,6-naphthyridine-2-carbonyl chloride has a molecular weight of 271.50 g/mol, XLogP of 2.77, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-1,6-naphthyridine-2-carbonyl chloride is sourced from PubChem (CID 58979587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).