C16H24F3N3O4 — CID 58979958
2,2,2-trifluoro-N-[6-[3-(2-hydroxybutyl)-2,6-dioxopyrimidin-1-yl]hexyl]acetamide (PubChem CID 58979958) has the molecular formula C16H24F3N3O4 and a molecular weight of 379.38 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[6-[3-(2-hydroxybutyl)-2,6-dioxopyrimidin-1-yl]hexyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[6-[3-(2-hydroxybutyl)-2,6-dioxopyrimidin-1-yl]hexyl]acetamide |
|---|---|
| PubChem CID | 58979958 |
| Molecular Formula | C16H24F3N3O4 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 2,2,2-trifluoro-N-[6-[3-(2-hydroxybutyl)-2,6-dioxopyrimidin-1-yl]hexyl]acetamide |
| SMILES | CCC(O)Cn1ccc(=O)n(CCCCCCNC(=O)C(F)(F)F)c1=O |
| InChI | InChI=1S/C16H24F3N3O4/c1-2-12(23)11-21-10-7-13(24)22(15(21)26)9-6-4-3-5-8-20-14(25)16(17,18)19/h7,10,12,23H,2-6,8-9,11H2,1H3,(H,20,25) |
| InChIKey | XGXAGGNKZBUICL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|