About 1-(2,3-dihydroxypropyl)-3-hex-5-ynylpyrimidine-2,4-dione
1-(2,3-dihydroxypropyl)-3-hex-5-ynylpyrimidine-2,4-dione (PubChem CID 58979959) has the molecular formula C13H18N2O4
and a molecular weight of 266.30 g/mol. Its IUPAC name is 1-(2,3-dihydroxypropyl)-3-hex-5-ynylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-(2,3-dihydroxypropyl)-3-hex-5-ynylpyrimidine-2,4-dione |
| PubChem CID | 58979959 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 1-(2,3-dihydroxypropyl)-3-hex-5-ynylpyrimidine-2,4-dione |
| SMILES | C#CCCCCn1c(=O)ccn(CC(O)CO)c1=O |
| InChI | InChI=1S/C13H18N2O4/c1-2-3-4-5-7-15-12(18)6-8-14(13(15)19)9-11(17)10-16/h1,6,8,11,16-17H,3-5,7,9-10H2 |
| InChIKey | RKVHUKUCJRDMEB-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,3-dihydroxypropyl)-3-hex-5-ynylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydroxypropyl)-3-hex-5-ynylpyrimidine-2,4-dione?
The IUPAC name of 1-(2,3-dihydroxypropyl)-3-hex-5-ynylpyrimidine-2,4-dione (CID 58979959) is 1-(2,3-dihydroxypropyl)-3-hex-5-ynylpyrimidine-2,4-dione.
What is the SMILES notation for 1-(2,3-dihydroxypropyl)-3-hex-5-ynylpyrimidine-2,4-dione?
The canonical SMILES for 1-(2,3-dihydroxypropyl)-3-hex-5-ynylpyrimidine-2,4-dione is C#CCCCCn1c(=O)ccn(CC(O)CO)c1=O.
What is the InChIKey of 1-(2,3-dihydroxypropyl)-3-hex-5-ynylpyrimidine-2,4-dione?
The InChIKey is RKVHUKUCJRDMEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O4/c1-2-3-4-5-7-15-12(18)6-8-14(13(15)19)9-11(17)10-16/h1,6,8,11,16-17H,3-5,7,9-10H2.
What are the key properties of 1-(2,3-dihydroxypropyl)-3-hex-5-ynylpyrimidine-2,4-dione?
1-(2,3-dihydroxypropyl)-3-hex-5-ynylpyrimidine-2,4-dione has a molecular weight of 266.30 g/mol, XLogP of -0.83, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydroxypropyl)-3-hex-5-ynylpyrimidine-2,4-dione is sourced from PubChem (CID 58979959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).