C30H31N7O — CID 58980067
3-[4-[1-ethyl-4-[2-(1,2,3,4-tetrahydroisoquinolin-7-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]phenyl]-1,1-dimethylurea (PubChem CID 58980067) has the molecular formula C30H31N7O and a molecular weight of 505.63 g/mol. Its IUPAC name is 3-[4-[1-ethyl-4-[2-(1,2,3,4-tetrahydroisoquinolin-7-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]phenyl]-1,1-dimethylurea.
| Compound Name | 3-[4-[1-ethyl-4-[2-(1,2,3,4-tetrahydroisoquinolin-7-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]phenyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 58980067 |
| Molecular Formula | C30H31N7O |
| Molecular Weight | 505.63 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | 3-[4-[1-ethyl-4-[2-(1,2,3,4-tetrahydroisoquinolin-7-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]pyrazol-3-yl]phenyl]-1,1-dimethylurea |
| SMILES | CCn1cc(-c2ccnc3[nH]c(-c4ccc5c(c4)CNCC5)cc23)c(-c2ccc(NC(=O)N(C)C)cc2)n1 |
| InChI | InChI=1S/C30H31N7O/c1-4-37-18-26(28(35-37)20-7-9-23(10-8-20)33-30(38)36(2)3)24-12-14-32-29-25(24)16-27(34-29)21-6-5-19-11-13-31-17-22(19)15-21/h5-10,12,14-16,18,31H,4,11,13,17H2,1-3H3,(H,32,34)(H,33,38) |
| InChIKey | ZDIPEQGACSBPKC-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.63 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |