C17H28FN3O3 — CID 58981758
tert-butyl N-[(2R,3S)-1-[(6-fluoro-2-pyridinyl)amino]-2-hydroxyheptan-3-yl]carbamate (PubChem CID 58981758) has the molecular formula C17H28FN3O3 and a molecular weight of 341.43 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-1-[(6-fluoro-2-pyridinyl)amino]-2-hydroxyheptan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S)-1-[(6-fluoro-2-pyridinyl)amino]-2-hydroxyheptan-3-yl]carbamate |
|---|---|
| PubChem CID | 58981758 |
| Molecular Formula | C17H28FN3O3 |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | tert-butyl N-[(2R,3S)-1-[(6-fluoro-2-pyridinyl)amino]-2-hydroxyheptan-3-yl]carbamate |
| SMILES | CCCC[C@H](NC(=O)OC(C)(C)C)[C@H](O)CNc1cccc(F)n1 |
| InChI | InChI=1S/C17H28FN3O3/c1-5-6-8-12(20-16(23)24-17(2,3)4)13(22)11-19-15-10-7-9-14(18)21-15/h7,9-10,12-13,22H,5-6,8,11H2,1-4H3,(H,19,21)(H,20,23)/t12-,13+/m0/s1 |
| InChIKey | KMEVDPDABYSIBK-QWHCGFSZSA-N |
| XLogP | 3.08 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|