C17H32O — CID 58982102
(3E,5E)-8-methoxy-2,2,7,7,9,9-hexamethyldeca-3,5-diene (PubChem CID 58982102) has the molecular formula C17H32O and a molecular weight of 252.44 g/mol. Its IUPAC name is (3E,5E)-8-methoxy-2,2,7,7,9,9-hexamethyldeca-3,5-diene.
| Compound Name | (3E,5E)-8-methoxy-2,2,7,7,9,9-hexamethyldeca-3,5-diene |
|---|---|
| PubChem CID | 58982102 |
| Molecular Formula | C17H32O |
| Molecular Weight | 252.44 g/mol |
| Exact Mass | 252.25 |
| IUPAC Name | (3E,5E)-8-methoxy-2,2,7,7,9,9-hexamethyldeca-3,5-diene |
| SMILES | COC(C(C)(C)C)C(C)(C)/C=C/C=C/C(C)(C)C |
| InChI | InChI=1S/C17H32O/c1-15(2,3)12-10-11-13-17(7,8)14(18-9)16(4,5)6/h10-14H,1-9H3/b12-10+,13-11+ |
| InChIKey | BPHFZJFUMXHYJO-DCIPZJNNSA-N |
| XLogP | 5.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.44 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|