C17H36O — CID 58982174
3-methoxy-2,2,4,4,9,9-hexamethyldecane (PubChem CID 58982174) has the molecular formula C17H36O and a molecular weight of 256.47 g/mol. Its IUPAC name is 3-methoxy-2,2,4,4,9,9-hexamethyldecane.
| Compound Name | 3-methoxy-2,2,4,4,9,9-hexamethyldecane |
|---|---|
| PubChem CID | 58982174 |
| Molecular Formula | C17H36O |
| Molecular Weight | 256.47 g/mol |
| Exact Mass | 256.28 |
| IUPAC Name | 3-methoxy-2,2,4,4,9,9-hexamethyldecane |
| SMILES | COC(C(C)(C)C)C(C)(C)CCCCC(C)(C)C |
| InChI | InChI=1S/C17H36O/c1-15(2,3)12-10-11-13-17(7,8)14(18-9)16(4,5)6/h14H,10-13H2,1-9H3 |
| InChIKey | SVFHTZLEHSDQTC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.47 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|