C15H28O — CID 58982193
(3E,5E)-8-methoxy-2,2,9,9-tetramethyldeca-3,5-diene (PubChem CID 58982193) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is (3E,5E)-8-methoxy-2,2,9,9-tetramethyldeca-3,5-diene.
| Compound Name | (3E,5E)-8-methoxy-2,2,9,9-tetramethyldeca-3,5-diene |
|---|---|
| PubChem CID | 58982193 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | (3E,5E)-8-methoxy-2,2,9,9-tetramethyldeca-3,5-diene |
| SMILES | COC(C/C=C/C=C/C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H28O/c1-14(2,3)12-10-8-9-11-13(16-7)15(4,5)6/h8-10,12-13H,11H2,1-7H3/b9-8+,12-10+ |
| InChIKey | RLWGBEFXEFGIJI-CDKJVOIVSA-N |
| XLogP | 4.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|