About methyl 8-[6-(3,4-dimethoxyphenyl)-3-pyridinyl]-8-oxooctanoate
methyl 8-[6-(3,4-dimethoxyphenyl)-3-pyridinyl]-8-oxooctanoate (PubChem CID 58982195) has the molecular formula C22H27NO5
and a molecular weight of 385.46 g/mol. Its IUPAC name is methyl 8-[6-(3,4-dimethoxyphenyl)-3-pyridinyl]-8-oxooctanoate.
Molecular Properties
| Compound Name | methyl 8-[6-(3,4-dimethoxyphenyl)-3-pyridinyl]-8-oxooctanoate |
| PubChem CID | 58982195 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | methyl 8-[6-(3,4-dimethoxyphenyl)-3-pyridinyl]-8-oxooctanoate |
| SMILES | COC(=O)CCCCCCC(=O)c1ccc(-c2ccc(OC)c(OC)c2)nc1 |
| InChI | InChI=1S/C22H27NO5/c1-26-20-13-11-16(14-21(20)27-2)18-12-10-17(15-23-18)19(24)8-6-4-5-7-9-22(25)28-3/h10-15H,4-9H2,1-3H3 |
| InChIKey | DMJXUQBMRQPSMG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 8-[6-(3,4-dimethoxyphenyl)-3-pyridinyl]-8-oxooctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-[6-(3,4-dimethoxyphenyl)-3-pyridinyl]-8-oxooctanoate?
The IUPAC name of methyl 8-[6-(3,4-dimethoxyphenyl)-3-pyridinyl]-8-oxooctanoate (CID 58982195) is methyl 8-[6-(3,4-dimethoxyphenyl)-3-pyridinyl]-8-oxooctanoate.
What is the SMILES notation for methyl 8-[6-(3,4-dimethoxyphenyl)-3-pyridinyl]-8-oxooctanoate?
The canonical SMILES for methyl 8-[6-(3,4-dimethoxyphenyl)-3-pyridinyl]-8-oxooctanoate is COC(=O)CCCCCCC(=O)c1ccc(-c2ccc(OC)c(OC)c2)nc1.
What is the InChIKey of methyl 8-[6-(3,4-dimethoxyphenyl)-3-pyridinyl]-8-oxooctanoate?
The InChIKey is DMJXUQBMRQPSMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO5/c1-26-20-13-11-16(14-21(20)27-2)18-12-10-17(15-23-18)19(24)8-6-4-5-7-9-22(25)28-3/h10-15H,4-9H2,1-3H3.
What are the key properties of methyl 8-[6-(3,4-dimethoxyphenyl)-3-pyridinyl]-8-oxooctanoate?
methyl 8-[6-(3,4-dimethoxyphenyl)-3-pyridinyl]-8-oxooctanoate has a molecular weight of 385.46 g/mol, XLogP of 4.46, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-[6-(3,4-dimethoxyphenyl)-3-pyridinyl]-8-oxooctanoate is sourced from PubChem (CID 58982195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).