C32H53NO3 — CID 58982350
4,4-dicyclohexyloxy-2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidine (PubChem CID 58982350) has the molecular formula C32H53NO3 and a molecular weight of 499.78 g/mol. Its IUPAC name is 4,4-dicyclohexyloxy-2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidine.
| Compound Name | 4,4-dicyclohexyloxy-2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidine |
|---|---|
| PubChem CID | 58982350 |
| Molecular Formula | C32H53NO3 |
| Molecular Weight | 499.78 g/mol |
| Exact Mass | 499.40 |
| IUPAC Name | 4,4-dicyclohexyloxy-2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidine |
| SMILES | CCC1(C)CC(OC2CCCCC2)(OC2CCCCC2)C(C)C(C)(CC)N1OC(C)c1ccccc1 |
| InChI | InChI=1S/C32H53NO3/c1-7-30(5)24-32(34-28-20-14-10-15-21-28,35-29-22-16-11-17-23-29)26(4)31(6,8-2)33(30)36-25(3)27-18-12-9-13-19-27/h9,12-13,18-19,25-26,28-29H,7-8,10-11,14-17,20-24H2,1-6H3 |
| InChIKey | SZSJRPWAHRGIBQ-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.78 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|