C23H26N2O2 — CID 58982527
(3S,6S)-1,3-dibenzyl-6-methyl-4-prop-2-enyl-1,4-diazepane-2,5-dione (PubChem CID 58982527) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is (3S,6S)-1,3-dibenzyl-6-methyl-4-prop-2-enyl-1,4-diazepane-2,5-dione.
| Compound Name | (3S,6S)-1,3-dibenzyl-6-methyl-4-prop-2-enyl-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 58982527 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | (3S,6S)-1,3-dibenzyl-6-methyl-4-prop-2-enyl-1,4-diazepane-2,5-dione |
| SMILES | C=CCN1C(=O)[C@@H](C)CN(Cc2ccccc2)C(=O)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C23H26N2O2/c1-3-14-25-21(15-19-10-6-4-7-11-19)23(27)24(16-18(2)22(25)26)17-20-12-8-5-9-13-20/h3-13,18,21H,1,14-17H2,2H3/t18-,21-/m0/s1 |
| InChIKey | BXAFJUKLKKKDFL-RXVVDRJESA-N |
| XLogP | 3.29 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|