C17H17N3O2 — CID 58982558
(E)-N-[(6R)-6-methyl-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-3-yl]-3-phenylprop-2-enamide (PubChem CID 58982558) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is (E)-N-[(6R)-6-methyl-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-3-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(6R)-6-methyl-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-3-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 58982558 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (E)-N-[(6R)-6-methyl-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-3-yl]-3-phenylprop-2-enamide |
| SMILES | C[C@@H]1CCc2ncc(NC(=O)/C=C/c3ccccc3)c(=O)n21 |
| InChI | InChI=1S/C17H17N3O2/c1-12-7-9-15-18-11-14(17(22)20(12)15)19-16(21)10-8-13-5-3-2-4-6-13/h2-6,8,10-12H,7,9H2,1H3,(H,19,21)/b10-8+/t12-/m1/s1 |
| InChIKey | HDPNFCQLOKDOCC-ZJNQMXKESA-N |
| XLogP | 2.40 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|