About 7-[(2-hydroxy-3,5-dimethylphenyl)methyl]-5-methyl-3-phenyl-3H-1-benzofuran-2-one
7-[(2-hydroxy-3,5-dimethylphenyl)methyl]-5-methyl-3-phenyl-3H-1-benzofuran-2-one (PubChem CID 58982777) has the molecular formula C24H22O3
and a molecular weight of 358.44 g/mol. Its IUPAC name is 7-[(2-hydroxy-3,5-dimethylphenyl)methyl]-5-methyl-3-phenyl-3H-1-benzofuran-2-one.
Molecular Properties
| Compound Name | 7-[(2-hydroxy-3,5-dimethylphenyl)methyl]-5-methyl-3-phenyl-3H-1-benzofuran-2-one |
| PubChem CID | 58982777 |
| Molecular Formula | C24H22O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 7-[(2-hydroxy-3,5-dimethylphenyl)methyl]-5-methyl-3-phenyl-3H-1-benzofuran-2-one |
| SMILES | Cc1cc(C)c(O)c(Cc2cc(C)cc3c2OC(=O)C3c2ccccc2)c1 |
| InChI | InChI=1S/C24H22O3/c1-14-9-16(3)22(25)18(10-14)13-19-11-15(2)12-20-21(24(26)27-23(19)20)17-7-5-4-6-8-17/h4-12,21,25H,13H2,1-3H3 |
| InChIKey | BFUBIBBSKSKOQU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 7-[(2-hydroxy-3,5-dimethylphenyl)methyl]-5-methyl-3-phenyl-3H-1-benzofuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(2-hydroxy-3,5-dimethylphenyl)methyl]-5-methyl-3-phenyl-3H-1-benzofuran-2-one?
The IUPAC name of 7-[(2-hydroxy-3,5-dimethylphenyl)methyl]-5-methyl-3-phenyl-3H-1-benzofuran-2-one (CID 58982777) is 7-[(2-hydroxy-3,5-dimethylphenyl)methyl]-5-methyl-3-phenyl-3H-1-benzofuran-2-one.
What is the SMILES notation for 7-[(2-hydroxy-3,5-dimethylphenyl)methyl]-5-methyl-3-phenyl-3H-1-benzofuran-2-one?
The canonical SMILES for 7-[(2-hydroxy-3,5-dimethylphenyl)methyl]-5-methyl-3-phenyl-3H-1-benzofuran-2-one is Cc1cc(C)c(O)c(Cc2cc(C)cc3c2OC(=O)C3c2ccccc2)c1.
What is the InChIKey of 7-[(2-hydroxy-3,5-dimethylphenyl)methyl]-5-methyl-3-phenyl-3H-1-benzofuran-2-one?
The InChIKey is BFUBIBBSKSKOQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22O3/c1-14-9-16(3)22(25)18(10-14)13-19-11-15(2)12-20-21(24(26)27-23(19)20)17-7-5-4-6-8-17/h4-12,21,25H,13H2,1-3H3.
What are the key properties of 7-[(2-hydroxy-3,5-dimethylphenyl)methyl]-5-methyl-3-phenyl-3H-1-benzofuran-2-one?
7-[(2-hydroxy-3,5-dimethylphenyl)methyl]-5-methyl-3-phenyl-3H-1-benzofuran-2-one has a molecular weight of 358.44 g/mol, XLogP of 4.96, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(2-hydroxy-3,5-dimethylphenyl)methyl]-5-methyl-3-phenyl-3H-1-benzofuran-2-one is sourced from PubChem (CID 58982777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).