C28H36N2O2S2 — CID 58982896
2,5-dihexyl-4-(4-methylthiophen-2-yl)-1-(5-methylthiophen-2-yl)pyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 58982896) has the molecular formula C28H36N2O2S2 and a molecular weight of 496.74 g/mol. Its IUPAC name is 2,5-dihexyl-4-(4-methylthiophen-2-yl)-1-(5-methylthiophen-2-yl)pyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 2,5-dihexyl-4-(4-methylthiophen-2-yl)-1-(5-methylthiophen-2-yl)pyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 58982896 |
| Molecular Formula | C28H36N2O2S2 |
| Molecular Weight | 496.74 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | 2,5-dihexyl-4-(4-methylthiophen-2-yl)-1-(5-methylthiophen-2-yl)pyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CCCCCCN1C(=O)C2=C(c3ccc(C)s3)N(CCCCCC)C(=O)C2=C1c1cc(C)cs1 |
| InChI | InChI=1S/C28H36N2O2S2/c1-5-7-9-11-15-29-25(21-14-13-20(4)34-21)23-24(28(29)32)26(22-17-19(3)18-33-22)30(27(23)31)16-12-10-8-6-2/h13-14,17-18H,5-12,15-16H2,1-4H3 |
| InChIKey | QJSGOHCUFRVCQW-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.74 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|