About 6-(4-fluoro-3-methylbenzene-6-id-1-yl)-5,5-dimethyl-3,4-dihydro-2H-pyridine;iridium
6-(4-fluoro-3-methylbenzene-6-id-1-yl)-5,5-dimethyl-3,4-dihydro-2H-pyridine;iridium (PubChem CID 58982975) has the molecular formula C14H17FIrN-
and a molecular weight of 410.51 g/mol. Its IUPAC name is 6-(4-fluoro-3-methylbenzene-6-id-1-yl)-5,5-dimethyl-3,4-dihydro-2H-pyridine;iridium.
Molecular Properties
| Compound Name | 6-(4-fluoro-3-methylbenzene-6-id-1-yl)-5,5-dimethyl-3,4-dihydro-2H-pyridine;iridium |
| PubChem CID | 58982975 |
| Molecular Formula | C14H17FIrN- |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 6-(4-fluoro-3-methylbenzene-6-id-1-yl)-5,5-dimethyl-3,4-dihydro-2H-pyridine;iridium |
| SMILES | Cc1cc(C2=NCCCC2(C)C)[c-]cc1F.[Ir] |
| InChI | InChI=1S/C14H17FN.Ir/c1-10-9-11(5-6-12(10)15)13-14(2,3)7-4-8-16-13;/h6,9H,4,7-8H2,1-3H3;/q-1; |
| InChIKey | AQPGQFGPCOHPBO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-fluoro-3-methylbenzene-6-id-1-yl)-5,5-dimethyl-3,4-dihydro-2H-pyridine;iridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-fluoro-3-methylbenzene-6-id-1-yl)-5,5-dimethyl-3,4-dihydro-2H-pyridine;iridium?
The IUPAC name of 6-(4-fluoro-3-methylbenzene-6-id-1-yl)-5,5-dimethyl-3,4-dihydro-2H-pyridine;iridium (CID 58982975) is 6-(4-fluoro-3-methylbenzene-6-id-1-yl)-5,5-dimethyl-3,4-dihydro-2H-pyridine;iridium.
What is the SMILES notation for 6-(4-fluoro-3-methylbenzene-6-id-1-yl)-5,5-dimethyl-3,4-dihydro-2H-pyridine;iridium?
The canonical SMILES for 6-(4-fluoro-3-methylbenzene-6-id-1-yl)-5,5-dimethyl-3,4-dihydro-2H-pyridine;iridium is Cc1cc(C2=NCCCC2(C)C)[c-]cc1F.[Ir].
What is the InChIKey of 6-(4-fluoro-3-methylbenzene-6-id-1-yl)-5,5-dimethyl-3,4-dihydro-2H-pyridine;iridium?
The InChIKey is AQPGQFGPCOHPBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17FN.Ir/c1-10-9-11(5-6-12(10)15)13-14(2,3)7-4-8-16-13;/h6,9H,4,7-8H2,1-3H3;/q-1;.
What are the key properties of 6-(4-fluoro-3-methylbenzene-6-id-1-yl)-5,5-dimethyl-3,4-dihydro-2H-pyridine;iridium?
6-(4-fluoro-3-methylbenzene-6-id-1-yl)-5,5-dimethyl-3,4-dihydro-2H-pyridine;iridium has a molecular weight of 410.51 g/mol, XLogP of 3.54, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-fluoro-3-methylbenzene-6-id-1-yl)-5,5-dimethyl-3,4-dihydro-2H-pyridine;iridium is sourced from PubChem (CID 58982975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).