C22H31IrNO2 — CID 58982985
5,5-dimethyl-6-(5,6,7,8-tetrahydro-3H-naphthalen-3-id-2-yl)-3,4-dihydro-2H-pyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium (PubChem CID 58982985) has the molecular formula C22H31IrNO2 and a molecular weight of 533.71 g/mol. Its IUPAC name is 5,5-dimethyl-6-(5,6,7,8-tetrahydro-3H-naphthalen-3-id-2-yl)-3,4-dihydro-2H-pyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium.
| Compound Name | 5,5-dimethyl-6-(5,6,7,8-tetrahydro-3H-naphthalen-3-id-2-yl)-3,4-dihydro-2H-pyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium |
|---|---|
| PubChem CID | 58982985 |
| Molecular Formula | C22H31IrNO2 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | 5,5-dimethyl-6-(5,6,7,8-tetrahydro-3H-naphthalen-3-id-2-yl)-3,4-dihydro-2H-pyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium |
| SMILES | CC1(C)CCCN=C1c1[c-]cc2c(c1)CCCC2.[H]/[O+]=C(C)/C=C(/C)O.[Ir] |
| InChI | InChI=1S/C17H22N.C5H8O2.Ir/c1-17(2)10-5-11-18-16(17)15-9-8-13-6-3-4-7-14(13)12-15;1-4(6)3-5(2)7;/h8,12H,3-7,10-11H2,1-2H3;3,6H,1-2H3;/q-1;;/p+1/b;4-3-; |
| InChIKey | QACRDWNGEJVLRT-LWFKIUJUSA-O |
| XLogP | 4.99 |
| TPSA | 53.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|