About 5,5-dimethyl-6-phenyl-2H-pyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium
5,5-dimethyl-6-phenyl-2H-pyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium (PubChem CID 58983015) has the molecular formula C18H23IrNO2
and a molecular weight of 477.60 g/mol. Its IUPAC name is 5,5-dimethyl-6-phenyl-2H-pyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium.
Molecular Properties
| Compound Name | 5,5-dimethyl-6-phenyl-2H-pyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium |
| PubChem CID | 58983015 |
| Molecular Formula | C18H23IrNO2 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 5,5-dimethyl-6-phenyl-2H-pyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium |
| SMILES | CC1(C)C=CCN=C1c1[c-]cccc1.[H]/[O+]=C(C)/C=C(/C)O.[Ir] |
| InChI | InChI=1S/C13H14N.C5H8O2.Ir/c1-13(2)9-6-10-14-12(13)11-7-4-3-5-8-11;1-4(6)3-5(2)7;/h3-7,9H,10H2,1-2H3;3,6H,1-2H3;/q-1;;/p+1/b;4-3-; |
| InChIKey | HXMNXGQJHHOELS-LWFKIUJUSA-O |
| XLogP | 3.88 |
| TPSA | 53.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-6-phenyl-2H-pyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-6-phenyl-2H-pyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium?
The IUPAC name of 5,5-dimethyl-6-phenyl-2H-pyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium (CID 58983015) is 5,5-dimethyl-6-phenyl-2H-pyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium.
What is the SMILES notation for 5,5-dimethyl-6-phenyl-2H-pyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium?
The canonical SMILES for 5,5-dimethyl-6-phenyl-2H-pyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium is CC1(C)C=CCN=C1c1[c-]cccc1.[H]/[O+]=C(C)/C=C(/C)O.[Ir].
What is the InChIKey of 5,5-dimethyl-6-phenyl-2H-pyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium?
The InChIKey is HXMNXGQJHHOELS-LWFKIUJUSA-O. The full InChI is InChI=1S/C13H14N.C5H8O2.Ir/c1-13(2)9-6-10-14-12(13)11-7-4-3-5-8-11;1-4(6)3-5(2)7;/h3-7,9H,10H2,1-2H3;3,6H,1-2H3;/q-1;;/p+1/b;4-3-;.
What are the key properties of 5,5-dimethyl-6-phenyl-2H-pyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium?
5,5-dimethyl-6-phenyl-2H-pyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium has a molecular weight of 477.60 g/mol, XLogP of 3.88, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-6-phenyl-2H-pyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium is sourced from PubChem (CID 58983015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).