About [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;6-phenylpyridine-2,5-dione
[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;6-phenylpyridine-2,5-dione (PubChem CID 58983018) has the molecular formula C16H15IrNO4
and a molecular weight of 477.52 g/mol. Its IUPAC name is [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;6-phenylpyridine-2,5-dione.
Molecular Properties
| Compound Name | [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;6-phenylpyridine-2,5-dione |
| PubChem CID | 58983018 |
| Molecular Formula | C16H15IrNO4 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;6-phenylpyridine-2,5-dione |
| SMILES | O=C1C=CC(=O)C(c2[c-]cccc2)=N1.[H]/[O+]=C(C)/C=C(/C)O.[Ir] |
| InChI | InChI=1S/C11H6NO2.C5H8O2.Ir/c13-9-6-7-10(14)12-11(9)8-4-2-1-3-5-8;1-4(6)3-5(2)7;/h1-4,6-7H;3,6H,1-2H3;/q-1;;/p+1/b;4-3-; |
| InChIKey | CANWDIQMBZOICS-LWFKIUJUSA-O |
| XLogP | 1.95 |
| TPSA | 88.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;6-phenylpyridine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;6-phenylpyridine-2,5-dione?
The IUPAC name of [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;6-phenylpyridine-2,5-dione (CID 58983018) is [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;6-phenylpyridine-2,5-dione.
What is the SMILES notation for [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;6-phenylpyridine-2,5-dione?
The canonical SMILES for [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;6-phenylpyridine-2,5-dione is O=C1C=CC(=O)C(c2[c-]cccc2)=N1.[H]/[O+]=C(C)/C=C(/C)O.[Ir].
What is the InChIKey of [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;6-phenylpyridine-2,5-dione?
The InChIKey is CANWDIQMBZOICS-LWFKIUJUSA-O. The full InChI is InChI=1S/C11H6NO2.C5H8O2.Ir/c13-9-6-7-10(14)12-11(9)8-4-2-1-3-5-8;1-4(6)3-5(2)7;/h1-4,6-7H;3,6H,1-2H3;/q-1;;/p+1/b;4-3-;.
What are the key properties of [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;6-phenylpyridine-2,5-dione?
[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;6-phenylpyridine-2,5-dione has a molecular weight of 477.52 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;6-phenylpyridine-2,5-dione is sourced from PubChem (CID 58983018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).