C19H25IrNO4 — CID 58983024
[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2,2,5,5-tetramethyl-4-phenyl-1,3-oxazin-6-one (PubChem CID 58983024) has the molecular formula C19H25IrNO4 and a molecular weight of 523.63 g/mol. Its IUPAC name is [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2,2,5,5-tetramethyl-4-phenyl-1,3-oxazin-6-one.
| Compound Name | [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2,2,5,5-tetramethyl-4-phenyl-1,3-oxazin-6-one |
|---|---|
| PubChem CID | 58983024 |
| Molecular Formula | C19H25IrNO4 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2,2,5,5-tetramethyl-4-phenyl-1,3-oxazin-6-one |
| SMILES | CC1(C)N=C(c2[c-]cccc2)C(C)(C)C(=O)O1.[H]/[O+]=C(C)/C=C(/C)O.[Ir] |
| InChI | InChI=1S/C14H16NO2.C5H8O2.Ir/c1-13(2)11(10-8-6-5-7-9-10)15-14(3,4)17-12(13)16;1-4(6)3-5(2)7;/h5-8H,1-4H3;3,6H,1-2H3;/q-1;;/p+1/b;4-3-; |
| InChIKey | SIHBBQYGQXPMEY-LWFKIUJUSA-O |
| XLogP | 3.61 |
| TPSA | 80.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|