About 2,2-dimethyl-6-phenyl-4,5-dihydro-3H-pyridine;iridium
2,2-dimethyl-6-phenyl-4,5-dihydro-3H-pyridine;iridium (PubChem CID 58983036) has the molecular formula C13H16IrN-
and a molecular weight of 378.50 g/mol. Its IUPAC name is 2,2-dimethyl-6-phenyl-4,5-dihydro-3H-pyridine;iridium.
Molecular Properties
| Compound Name | 2,2-dimethyl-6-phenyl-4,5-dihydro-3H-pyridine;iridium |
| PubChem CID | 58983036 |
| Molecular Formula | C13H16IrN- |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 2,2-dimethyl-6-phenyl-4,5-dihydro-3H-pyridine;iridium |
| SMILES | CC1(C)CCCC(c2[c-]cccc2)=N1.[Ir] |
| InChI | InChI=1S/C13H16N.Ir/c1-13(2)10-6-9-12(14-13)11-7-4-3-5-8-11;/h3-5,7H,6,9-10H2,1-2H3;/q-1; |
| InChIKey | WNDXEWFCCRUIEV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-6-phenyl-4,5-dihydro-3H-pyridine;iridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-6-phenyl-4,5-dihydro-3H-pyridine;iridium?
The IUPAC name of 2,2-dimethyl-6-phenyl-4,5-dihydro-3H-pyridine;iridium (CID 58983036) is 2,2-dimethyl-6-phenyl-4,5-dihydro-3H-pyridine;iridium.
What is the SMILES notation for 2,2-dimethyl-6-phenyl-4,5-dihydro-3H-pyridine;iridium?
The canonical SMILES for 2,2-dimethyl-6-phenyl-4,5-dihydro-3H-pyridine;iridium is CC1(C)CCCC(c2[c-]cccc2)=N1.[Ir].
What is the InChIKey of 2,2-dimethyl-6-phenyl-4,5-dihydro-3H-pyridine;iridium?
The InChIKey is WNDXEWFCCRUIEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N.Ir/c1-13(2)10-6-9-12(14-13)11-7-4-3-5-8-11;/h3-5,7H,6,9-10H2,1-2H3;/q-1;.
What are the key properties of 2,2-dimethyl-6-phenyl-4,5-dihydro-3H-pyridine;iridium?
2,2-dimethyl-6-phenyl-4,5-dihydro-3H-pyridine;iridium has a molecular weight of 378.50 g/mol, XLogP of 3.24, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-6-phenyl-4,5-dihydro-3H-pyridine;iridium is sourced from PubChem (CID 58983036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).