C19H27IrNO3 — CID 58983062
[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;6-(4-methoxybenzene-6-id-1-yl)-5,5-dimethyl-3,4-dihydro-2H-pyridine (PubChem CID 58983062) has the molecular formula C19H27IrNO3 and a molecular weight of 509.65 g/mol. Its IUPAC name is [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;6-(4-methoxybenzene-6-id-1-yl)-5,5-dimethyl-3,4-dihydro-2H-pyridine.
| Compound Name | [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;6-(4-methoxybenzene-6-id-1-yl)-5,5-dimethyl-3,4-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 58983062 |
| Molecular Formula | C19H27IrNO3 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;6-(4-methoxybenzene-6-id-1-yl)-5,5-dimethyl-3,4-dihydro-2H-pyridine |
| SMILES | COc1c[c-]c(C2=NCCCC2(C)C)cc1.[H]/[O+]=C(C)/C=C(/C)O.[Ir] |
| InChI | InChI=1S/C14H18NO.C5H8O2.Ir/c1-14(2)9-4-10-15-13(14)11-5-7-12(16-3)8-6-11;1-4(6)3-5(2)7;/h5,7-8H,4,9-10H2,1-3H3;3,6H,1-2H3;/q-1;;/p+1/b;4-3-; |
| InChIKey | VMWDRPGJIOXPSG-LWFKIUJUSA-O |
| XLogP | 4.11 |
| TPSA | 63.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|