C22H25IrNO2 — CID 58983095
[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2-phenyl-3,4,5,6-tetrahydro-1-benzazocine (PubChem CID 58983095) has the molecular formula C22H25IrNO2 and a molecular weight of 527.66 g/mol. Its IUPAC name is [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2-phenyl-3,4,5,6-tetrahydro-1-benzazocine.
| Compound Name | [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2-phenyl-3,4,5,6-tetrahydro-1-benzazocine |
|---|---|
| PubChem CID | 58983095 |
| Molecular Formula | C22H25IrNO2 |
| Molecular Weight | 527.66 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;2-phenyl-3,4,5,6-tetrahydro-1-benzazocine |
| SMILES | [H]/[O+]=C(C)/C=C(/C)O.[Ir].[c-]1ccccc1/C1=N/c2ccccc2CCCC1 |
| InChI | InChI=1S/C17H16N.C5H8O2.Ir/c1-2-8-14(9-3-1)16-12-6-4-10-15-11-5-7-13-17(15)18-16;1-4(6)3-5(2)7;/h1-3,5,7-8,11,13H,4,6,10,12H2;3,6H,1-2H3;/q-1;;/p+1/b18-16+;4-3-; |
| InChIKey | XLBGPDJSFSHLHF-BDRNFAHFSA-O |
| XLogP | 5.34 |
| TPSA | 53.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.66 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|