About 2-(3-methylimidazol-4-yl)-5,6-dihydro-4H-1,3-oxazine
2-(3-methylimidazol-4-yl)-5,6-dihydro-4H-1,3-oxazine (PubChem CID 58983131) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is 2-(3-methylimidazol-4-yl)-5,6-dihydro-4H-1,3-oxazine.
Molecular Properties
| Compound Name | 2-(3-methylimidazol-4-yl)-5,6-dihydro-4H-1,3-oxazine |
| PubChem CID | 58983131 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 2-(3-methylimidazol-4-yl)-5,6-dihydro-4H-1,3-oxazine |
| SMILES | Cn1cncc1C1=NCCCO1 |
| InChI | InChI=1S/C8H11N3O/c1-11-6-9-5-7(11)8-10-3-2-4-12-8/h5-6H,2-4H2,1H3 |
| InChIKey | KXMHONRXNIRXAI-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-methylimidazol-4-yl)-5,6-dihydro-4H-1,3-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylimidazol-4-yl)-5,6-dihydro-4H-1,3-oxazine?
The IUPAC name of 2-(3-methylimidazol-4-yl)-5,6-dihydro-4H-1,3-oxazine (CID 58983131) is 2-(3-methylimidazol-4-yl)-5,6-dihydro-4H-1,3-oxazine.
What is the SMILES notation for 2-(3-methylimidazol-4-yl)-5,6-dihydro-4H-1,3-oxazine?
The canonical SMILES for 2-(3-methylimidazol-4-yl)-5,6-dihydro-4H-1,3-oxazine is Cn1cncc1C1=NCCCO1.
What is the InChIKey of 2-(3-methylimidazol-4-yl)-5,6-dihydro-4H-1,3-oxazine?
The InChIKey is KXMHONRXNIRXAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O/c1-11-6-9-5-7(11)8-10-3-2-4-12-8/h5-6H,2-4H2,1H3.
What are the key properties of 2-(3-methylimidazol-4-yl)-5,6-dihydro-4H-1,3-oxazine?
2-(3-methylimidazol-4-yl)-5,6-dihydro-4H-1,3-oxazine has a molecular weight of 165.20 g/mol, XLogP of 0.59, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylimidazol-4-yl)-5,6-dihydro-4H-1,3-oxazine is sourced from PubChem (CID 58983131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).