C15H18IrN- — CID 58983183
iridium;2,2,5,5-tetramethyl-6-phenylpyridine (PubChem CID 58983183) has the molecular formula C15H18IrN- and a molecular weight of 404.53 g/mol. Its IUPAC name is iridium;2,2,5,5-tetramethyl-6-phenylpyridine.
| Compound Name | iridium;2,2,5,5-tetramethyl-6-phenylpyridine |
|---|---|
| PubChem CID | 58983183 |
| Molecular Formula | C15H18IrN- |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | iridium;2,2,5,5-tetramethyl-6-phenylpyridine |
| SMILES | CC1(C)C=CC(C)(C)C(c2[c-]cccc2)=N1.[Ir] |
| InChI | InChI=1S/C15H18N.Ir/c1-14(2)10-11-15(3,4)16-13(14)12-8-6-5-7-9-12;/h5-8,10-11H,1-4H3;/q-1; |
| InChIKey | ZJNBISAWRDJWGV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|