C16H11F10IrNO2 — CID 58983216
6-(2,4-difluorobenzene-6-id-1-yl)-2,2,3,3,4,4,5,5-octafluoropyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium (PubChem CID 58983216) has the molecular formula C16H11F10IrNO2 and a molecular weight of 631.47 g/mol. Its IUPAC name is 6-(2,4-difluorobenzene-6-id-1-yl)-2,2,3,3,4,4,5,5-octafluoropyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium.
| Compound Name | 6-(2,4-difluorobenzene-6-id-1-yl)-2,2,3,3,4,4,5,5-octafluoropyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium |
|---|---|
| PubChem CID | 58983216 |
| Molecular Formula | C16H11F10IrNO2 |
| Molecular Weight | 631.47 g/mol |
| Exact Mass | 632.03 |
| IUPAC Name | 6-(2,4-difluorobenzene-6-id-1-yl)-2,2,3,3,4,4,5,5-octafluoropyridine;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium |
| SMILES | Fc1c[c-]c(C2=NC(F)(F)C(F)(F)C(F)(F)C2(F)F)c(F)c1.[H]/[O+]=C(C)/C=C(/C)O.[Ir] |
| InChI | InChI=1S/C11H2F10N.C5H8O2.Ir/c12-4-1-2-5(6(13)3-4)7-8(14,15)9(16,17)10(18,19)11(20,21)22-7;1-4(6)3-5(2)7;/h1,3H;3,6H,1-2H3;/q-1;;/p+1/b;4-3-; |
| InChIKey | VKCKBVNIYZMYOF-LWFKIUJUSA-O |
| XLogP | 5.08 |
| TPSA | 53.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|