C14H18IrN- — CID 58983282
6,6-dimethyl-7-phenyl-2,3,4,5-tetrahydroazepine;iridium (PubChem CID 58983282) has the molecular formula C14H18IrN- and a molecular weight of 392.52 g/mol. Its IUPAC name is 6,6-dimethyl-7-phenyl-2,3,4,5-tetrahydroazepine;iridium.
| Compound Name | 6,6-dimethyl-7-phenyl-2,3,4,5-tetrahydroazepine;iridium |
|---|---|
| PubChem CID | 58983282 |
| Molecular Formula | C14H18IrN- |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 6,6-dimethyl-7-phenyl-2,3,4,5-tetrahydroazepine;iridium |
| SMILES | CC1(C)CCCCN=C1c1[c-]cccc1.[Ir] |
| InChI | InChI=1S/C14H18N.Ir/c1-14(2)10-6-7-11-15-13(14)12-8-4-3-5-9-12;/h3-5,8H,6-7,10-11H2,1-2H3;/q-1; |
| InChIKey | ZORHMXTUKLJKSI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|