About 5,5-dimethyl-6-(3-octylbenzene-6-id-1-yl)-3,4-dihydropyridin-2-one;iridium
5,5-dimethyl-6-(3-octylbenzene-6-id-1-yl)-3,4-dihydropyridin-2-one;iridium (PubChem CID 58983290) has the molecular formula C21H30IrNO-
and a molecular weight of 504.69 g/mol. Its IUPAC name is 5,5-dimethyl-6-(3-octylbenzene-6-id-1-yl)-3,4-dihydropyridin-2-one;iridium.
Molecular Properties
| Compound Name | 5,5-dimethyl-6-(3-octylbenzene-6-id-1-yl)-3,4-dihydropyridin-2-one;iridium |
| PubChem CID | 58983290 |
| Molecular Formula | C21H30IrNO- |
| Molecular Weight | 504.69 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 5,5-dimethyl-6-(3-octylbenzene-6-id-1-yl)-3,4-dihydropyridin-2-one;iridium |
| SMILES | CCCCCCCCc1cc[c-]c(C2=NC(=O)CCC2(C)C)c1.[Ir] |
| InChI | InChI=1S/C21H30NO.Ir/c1-4-5-6-7-8-9-11-17-12-10-13-18(16-17)20-21(2,3)15-14-19(23)22-20;/h10,12,16H,4-9,11,14-15H2,1-3H3;/q-1; |
| InChIKey | QEMUVMQRMNUXJH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 504.69 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-6-(3-octylbenzene-6-id-1-yl)-3,4-dihydropyridin-2-one;iridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-6-(3-octylbenzene-6-id-1-yl)-3,4-dihydropyridin-2-one;iridium?
The IUPAC name of 5,5-dimethyl-6-(3-octylbenzene-6-id-1-yl)-3,4-dihydropyridin-2-one;iridium (CID 58983290) is 5,5-dimethyl-6-(3-octylbenzene-6-id-1-yl)-3,4-dihydropyridin-2-one;iridium.
What is the SMILES notation for 5,5-dimethyl-6-(3-octylbenzene-6-id-1-yl)-3,4-dihydropyridin-2-one;iridium?
The canonical SMILES for 5,5-dimethyl-6-(3-octylbenzene-6-id-1-yl)-3,4-dihydropyridin-2-one;iridium is CCCCCCCCc1cc[c-]c(C2=NC(=O)CCC2(C)C)c1.[Ir].
What is the InChIKey of 5,5-dimethyl-6-(3-octylbenzene-6-id-1-yl)-3,4-dihydropyridin-2-one;iridium?
The InChIKey is QEMUVMQRMNUXJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30NO.Ir/c1-4-5-6-7-8-9-11-17-12-10-13-18(16-17)20-21(2,3)15-14-19(23)22-20;/h10,12,16H,4-9,11,14-15H2,1-3H3;/q-1;.
What are the key properties of 5,5-dimethyl-6-(3-octylbenzene-6-id-1-yl)-3,4-dihydropyridin-2-one;iridium?
5,5-dimethyl-6-(3-octylbenzene-6-id-1-yl)-3,4-dihydropyridin-2-one;iridium has a molecular weight of 504.69 g/mol, XLogP of 5.52, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-6-(3-octylbenzene-6-id-1-yl)-3,4-dihydropyridin-2-one;iridium is sourced from PubChem (CID 58983290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).