C8H3F13O2 — CID 58983400
1,1,1,2,3,3-hexafluoro-2-(1,1,2,2-tetrafluoropropoxy)-3-(1,2,2-trifluoroethenoxy)propane (PubChem CID 58983400) has the molecular formula C8H3F13O2 and a molecular weight of 378.08 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-2-(1,1,2,2-tetrafluoropropoxy)-3-(1,2,2-trifluoroethenoxy)propane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-2-(1,1,2,2-tetrafluoropropoxy)-3-(1,2,2-trifluoroethenoxy)propane |
|---|---|
| PubChem CID | 58983400 |
| Molecular Formula | C8H3F13O2 |
| Molecular Weight | 378.08 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-2-(1,1,2,2-tetrafluoropropoxy)-3-(1,2,2-trifluoroethenoxy)propane |
| SMILES | CC(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)=C(F)F |
| InChI | InChI=1S/C8H3F13O2/c1-4(12,13)7(18,19)23-5(14,6(15,16)17)8(20,21)22-3(11)2(9)10/h1H3 |
| InChIKey | GJUPPLMAOIIDRE-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.08 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|