C22H26NPt- — CID 58983425
10,10-dimethyl-5-(5,6,7,8-tetrahydro-3H-naphthalen-3-id-2-yl)-4-azatricyclo[7.1.1.02,7]undeca-2,4-diene;platinum (PubChem CID 58983425) has the molecular formula C22H26NPt- and a molecular weight of 499.54 g/mol. Its IUPAC name is 10,10-dimethyl-5-(5,6,7,8-tetrahydro-3H-naphthalen-3-id-2-yl)-4-azatricyclo[7.1.1.02,7]undeca-2,4-diene;platinum.
| Compound Name | 10,10-dimethyl-5-(5,6,7,8-tetrahydro-3H-naphthalen-3-id-2-yl)-4-azatricyclo[7.1.1.02,7]undeca-2,4-diene;platinum |
|---|---|
| PubChem CID | 58983425 |
| Molecular Formula | C22H26NPt- |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 10,10-dimethyl-5-(5,6,7,8-tetrahydro-3H-naphthalen-3-id-2-yl)-4-azatricyclo[7.1.1.02,7]undeca-2,4-diene;platinum |
| SMILES | CC1(C)C2CC3CC(c4[c-]cc5c(c4)CCCC5)=NC=C3C1C2.[Pt] |
| InChI | InChI=1S/C22H26N.Pt/c1-22(2)18-10-17-11-21(23-13-19(17)20(22)12-18)16-8-7-14-5-3-4-6-15(14)9-16;/h7,9,13,17-18,20H,3-6,10-12H2,1-2H3;/q-1; |
| InChIKey | LIXDRCMBWBARHJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|