C26H32IrN2 — CID 58983508
iridium;1,5,5,8,8-pentamethyl-3-(5,6,7,8-tetrahydro-3H-naphthalen-3-id-2-yl)-6,7-dihydro-2H-benzo[f]benzimidazol-2-ylium (PubChem CID 58983508) has the molecular formula C26H32IrN2 and a molecular weight of 564.77 g/mol. Its IUPAC name is iridium;1,5,5,8,8-pentamethyl-3-(5,6,7,8-tetrahydro-3H-naphthalen-3-id-2-yl)-6,7-dihydro-2H-benzo[f]benzimidazol-2-ylium.
| Compound Name | iridium;1,5,5,8,8-pentamethyl-3-(5,6,7,8-tetrahydro-3H-naphthalen-3-id-2-yl)-6,7-dihydro-2H-benzo[f]benzimidazol-2-ylium |
|---|---|
| PubChem CID | 58983508 |
| Molecular Formula | C26H32IrN2 |
| Molecular Weight | 564.77 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | iridium;1,5,5,8,8-pentamethyl-3-(5,6,7,8-tetrahydro-3H-naphthalen-3-id-2-yl)-6,7-dihydro-2H-benzo[f]benzimidazol-2-ylium |
| SMILES | Cn1[cH+]n(-c2[c-]cc3c(c2)CCCC3)c2cc3c(cc21)C(C)(C)CCC3(C)C.[Ir] |
| InChI | InChI=1S/C26H32N2.Ir/c1-25(2)12-13-26(3,4)22-16-24-23(15-21(22)25)27(5)17-28(24)20-11-10-18-8-6-7-9-19(18)14-20;/h10,14-17H,6-9,12-13H2,1-5H3; |
| InChIKey | KBGFYDUTXLTRTL-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.77 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|