C34H26F12O9S2 — CID 58983585
6-[5-[4-[4-(2,4-dimethoxyphenyl)-3-methoxyphenoxy]phenyl]sulfonyl-2-methylphenyl]-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane-1-sulfonic acid (PubChem CID 58983585) has the molecular formula C34H26F12O9S2 and a molecular weight of 870.68 g/mol. Its IUPAC name is 6-[5-[4-[4-(2,4-dimethoxyphenyl)-3-methoxyphenoxy]phenyl]sulfonyl-2-methylphenyl]-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane-1-sulfonic acid.
| Compound Name | 6-[5-[4-[4-(2,4-dimethoxyphenyl)-3-methoxyphenoxy]phenyl]sulfonyl-2-methylphenyl]-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane-1-sulfonic acid |
|---|---|
| PubChem CID | 58983585 |
| Molecular Formula | C34H26F12O9S2 |
| Molecular Weight | 870.68 g/mol |
| Exact Mass | 870.08 |
| IUPAC Name | 6-[5-[4-[4-(2,4-dimethoxyphenyl)-3-methoxyphenoxy]phenyl]sulfonyl-2-methylphenyl]-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane-1-sulfonic acid |
| SMILES | COc1ccc(-c2ccc(Oc3ccc(S(=O)(=O)c4ccc(C)c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)c4)cc3)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C34H26F12O9S2/c1-18-5-10-23(17-26(18)29(35,36)30(37,38)31(39,40)32(41,42)33(43,44)34(45,46)57(49,50)51)56(47,48)22-11-6-19(7-12-22)55-21-9-14-25(28(16-21)54-4)24-13-8-20(52-2)15-27(24)53-3/h5-17H,1-4H3,(H,49,50,51) |
| InChIKey | QOBVFSDYUXTRBC-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.68 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|