C32H22F12O6S2 — CID 58983594
1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[5-[4-[4-(4-methoxyphenyl)phenoxy]phenyl]sulfinyl-2-methylphenyl]hexane-1-sulfonic acid (PubChem CID 58983594) has the molecular formula C32H22F12O6S2 and a molecular weight of 794.63 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[5-[4-[4-(4-methoxyphenyl)phenoxy]phenyl]sulfinyl-2-methylphenyl]hexane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[5-[4-[4-(4-methoxyphenyl)phenoxy]phenyl]sulfinyl-2-methylphenyl]hexane-1-sulfonic acid |
|---|---|
| PubChem CID | 58983594 |
| Molecular Formula | C32H22F12O6S2 |
| Molecular Weight | 794.63 g/mol |
| Exact Mass | 794.07 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[5-[4-[4-(4-methoxyphenyl)phenoxy]phenyl]sulfinyl-2-methylphenyl]hexane-1-sulfonic acid |
| SMILES | COc1ccc(-c2ccc(Oc3ccc(S(=O)c4ccc(C)c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H22F12O6S2/c1-18-3-14-25(17-26(18)27(33,34)28(35,36)29(37,38)30(39,40)31(41,42)32(43,44)52(46,47)48)51(45)24-15-12-23(13-16-24)50-22-10-6-20(7-11-22)19-4-8-21(49-2)9-5-19/h3-17H,1-2H3,(H,46,47,48) |
| InChIKey | WFRKJBDDANMBSA-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.63 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|