C36H26F16O9S2 — CID 58983598
8-[5-[4-[4-(3,4-dimethoxyphenyl)-2-methoxyphenoxy]phenyl]sulfonyl-2-methylphenyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctane-1-sulfonic acid (PubChem CID 58983598) has the molecular formula C36H26F16O9S2 and a molecular weight of 970.70 g/mol. Its IUPAC name is 8-[5-[4-[4-(3,4-dimethoxyphenyl)-2-methoxyphenoxy]phenyl]sulfonyl-2-methylphenyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctane-1-sulfonic acid.
| Compound Name | 8-[5-[4-[4-(3,4-dimethoxyphenyl)-2-methoxyphenoxy]phenyl]sulfonyl-2-methylphenyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctane-1-sulfonic acid |
|---|---|
| PubChem CID | 58983598 |
| Molecular Formula | C36H26F16O9S2 |
| Molecular Weight | 970.70 g/mol |
| Exact Mass | 970.08 |
| IUPAC Name | 8-[5-[4-[4-(3,4-dimethoxyphenyl)-2-methoxyphenoxy]phenyl]sulfonyl-2-methylphenyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctane-1-sulfonic acid |
| SMILES | COc1ccc(-c2ccc(Oc3ccc(S(=O)(=O)c4ccc(C)c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)c4)cc3)c(OC)c2)cc1OC |
| InChI | InChI=1S/C36H26F16O9S2/c1-18-5-10-23(17-24(18)29(37,38)30(39,40)31(41,42)32(43,44)33(45,46)34(47,48)35(49,50)36(51,52)63(55,56)57)62(53,54)22-11-8-21(9-12-22)61-26-14-7-20(16-28(26)60-4)19-6-13-25(58-2)27(15-19)59-3/h5-17H,1-4H3,(H,55,56,57) |
| InChIKey | MIMXEFHWEBWONY-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 970.70 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|