C47H30F16O7S2 — CID 58983599
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-[5-[4-[4-[9-(4-methoxyphenyl)fluoren-9-yl]phenoxy]phenyl]sulfonyl-2-methylphenyl]octane-1-sulfonic acid (PubChem CID 58983599) has the molecular formula C47H30F16O7S2 and a molecular weight of 1074.85 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-[5-[4-[4-[9-(4-methoxyphenyl)fluoren-9-yl]phenoxy]phenyl]sulfonyl-2-methylphenyl]octane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-[5-[4-[4-[9-(4-methoxyphenyl)fluoren-9-yl]phenoxy]phenyl]sulfonyl-2-methylphenyl]octane-1-sulfonic acid |
|---|---|
| PubChem CID | 58983599 |
| Molecular Formula | C47H30F16O7S2 |
| Molecular Weight | 1074.85 g/mol |
| Exact Mass | 1074.12 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-[5-[4-[4-[9-(4-methoxyphenyl)fluoren-9-yl]phenoxy]phenyl]sulfonyl-2-methylphenyl]octane-1-sulfonic acid |
| SMILES | COc1ccc(C2(c3ccc(Oc4ccc(S(=O)(=O)c5ccc(C)c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)c5)cc4)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C47H30F16O7S2/c1-26-11-22-33(25-38(26)40(48,49)41(50,51)42(52,53)43(54,55)44(56,57)45(58,59)46(60,61)47(62,63)72(66,67)68)71(64,65)32-23-20-31(21-24-32)70-30-18-14-28(15-19-30)39(27-12-16-29(69-2)17-13-27)36-9-5-3-7-34(36)35-8-4-6-10-37(35)39/h3-25H,1-2H3,(H,66,67,68) |
| InChIKey | DNERFNWYFCNAOC-UHFFFAOYSA-N |
| XLogP | 13.38 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1074.85 |
| LogP ≤ 5 | 13.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|