C26H18F12O7S2 — CID 58983603
1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[5-[4-(4-methoxyphenoxy)phenyl]sulfonyl-2-methylphenyl]hexane-1-sulfonic acid (PubChem CID 58983603) has the molecular formula C26H18F12O7S2 and a molecular weight of 734.53 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[5-[4-(4-methoxyphenoxy)phenyl]sulfonyl-2-methylphenyl]hexane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[5-[4-(4-methoxyphenoxy)phenyl]sulfonyl-2-methylphenyl]hexane-1-sulfonic acid |
|---|---|
| PubChem CID | 58983603 |
| Molecular Formula | C26H18F12O7S2 |
| Molecular Weight | 734.53 g/mol |
| Exact Mass | 734.03 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[5-[4-(4-methoxyphenoxy)phenyl]sulfonyl-2-methylphenyl]hexane-1-sulfonic acid |
| SMILES | COc1ccc(Oc2ccc(S(=O)(=O)c3ccc(C)c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)c3)cc2)cc1 |
| InChI | InChI=1S/C26H18F12O7S2/c1-14-3-10-19(46(39,40)18-11-8-17(9-12-18)45-16-6-4-15(44-2)5-7-16)13-20(14)21(27,28)22(29,30)23(31,32)24(33,34)25(35,36)26(37,38)47(41,42)43/h3-13H,1-2H3,(H,41,42,43) |
| InChIKey | LWVKSBRWZDVSPE-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.53 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|