C42H30F8O8S2 — CID 58983614
1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[5-[4-[4-[4-[4-(4-methoxyphenyl)phenyl]phenyl]phenoxy]phenyl]sulfonyl-2-methylphenyl]ethoxy]ethanesulfonic acid (PubChem CID 58983614) has the molecular formula C42H30F8O8S2 and a molecular weight of 878.81 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[5-[4-[4-[4-[4-(4-methoxyphenyl)phenyl]phenyl]phenoxy]phenyl]sulfonyl-2-methylphenyl]ethoxy]ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[5-[4-[4-[4-[4-(4-methoxyphenyl)phenyl]phenyl]phenoxy]phenyl]sulfonyl-2-methylphenyl]ethoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 58983614 |
| Molecular Formula | C42H30F8O8S2 |
| Molecular Weight | 878.81 g/mol |
| Exact Mass | 878.13 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[5-[4-[4-[4-[4-(4-methoxyphenyl)phenyl]phenyl]phenoxy]phenyl]sulfonyl-2-methylphenyl]ethoxy]ethanesulfonic acid |
| SMILES | COc1ccc(-c2ccc(-c3ccc(-c4ccc(Oc5ccc(S(=O)(=O)c6ccc(C)c(C(F)(F)C(F)(F)OC(F)(F)C(F)(F)S(=O)(=O)O)c6)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C42H30F8O8S2/c1-26-3-22-37(25-38(26)39(43,44)40(45,46)58-41(47,48)42(49,50)60(53,54)55)59(51,52)36-23-20-35(21-24-36)57-34-18-14-32(15-19-34)30-10-6-28(7-11-30)27-4-8-29(9-5-27)31-12-16-33(56-2)17-13-31/h3-25H,1-2H3,(H,53,54,55) |
| InChIKey | WFIFRXXUPXAREH-UHFFFAOYSA-N |
| XLogP | 11.40 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.81 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|