C32H26F8O7S2 — CID 58983615
1,1,2,2,3,3,4,4-octafluoro-4-[5-[4-[4-(4-methoxy-3-methylphenyl)-2-methylphenoxy]phenyl]sulfonyl-2-methylphenyl]butane-1-sulfonic acid (PubChem CID 58983615) has the molecular formula C32H26F8O7S2 and a molecular weight of 738.67 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluoro-4-[5-[4-[4-(4-methoxy-3-methylphenyl)-2-methylphenoxy]phenyl]sulfonyl-2-methylphenyl]butane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3,4,4-octafluoro-4-[5-[4-[4-(4-methoxy-3-methylphenyl)-2-methylphenoxy]phenyl]sulfonyl-2-methylphenyl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 58983615 |
| Molecular Formula | C32H26F8O7S2 |
| Molecular Weight | 738.67 g/mol |
| Exact Mass | 738.10 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluoro-4-[5-[4-[4-(4-methoxy-3-methylphenyl)-2-methylphenoxy]phenyl]sulfonyl-2-methylphenyl]butane-1-sulfonic acid |
| SMILES | COc1ccc(-c2ccc(Oc3ccc(S(=O)(=O)c4ccc(C)c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)c4)cc3)c(C)c2)cc1C |
| InChI | InChI=1S/C32H26F8O7S2/c1-18-5-10-25(17-26(18)29(33,34)30(35,36)31(37,38)32(39,40)49(43,44)45)48(41,42)24-11-8-23(9-12-24)47-28-14-7-22(16-20(28)3)21-6-13-27(46-4)19(2)15-21/h5-17H,1-4H3,(H,43,44,45) |
| InChIKey | LRVCASHXPMSEDH-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.67 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|