C28H20F8O8S2 — CID 58983616
1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[5-[4-(1-methoxynaphthalen-2-yl)oxyphenyl]sulfonyl-2-methylphenyl]ethoxy]ethanesulfonic acid (PubChem CID 58983616) has the molecular formula C28H20F8O8S2 and a molecular weight of 700.58 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[5-[4-(1-methoxynaphthalen-2-yl)oxyphenyl]sulfonyl-2-methylphenyl]ethoxy]ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[5-[4-(1-methoxynaphthalen-2-yl)oxyphenyl]sulfonyl-2-methylphenyl]ethoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 58983616 |
| Molecular Formula | C28H20F8O8S2 |
| Molecular Weight | 700.58 g/mol |
| Exact Mass | 700.05 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[5-[4-(1-methoxynaphthalen-2-yl)oxyphenyl]sulfonyl-2-methylphenyl]ethoxy]ethanesulfonic acid |
| SMILES | COc1c(Oc2ccc(S(=O)(=O)c3ccc(C)c(C(F)(F)C(F)(F)OC(F)(F)C(F)(F)S(=O)(=O)O)c3)cc2)ccc2ccccc12 |
| InChI | InChI=1S/C28H20F8O8S2/c1-16-7-11-20(15-22(16)25(29,30)26(31,32)44-27(33,34)28(35,36)46(39,40)41)45(37,38)19-12-9-18(10-13-19)43-23-14-8-17-5-3-4-6-21(17)24(23)42-2/h3-15H,1-2H3,(H,39,40,41) |
| InChIKey | VXFRMSSOTZRHRO-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.58 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|