C35H28F12O7S2 — CID 58983617
1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[5-[4-[4-[2-(4-methoxyphenyl)propan-2-yl]phenoxy]phenyl]sulfonyl-2-methylphenyl]hexane-1-sulfonic acid (PubChem CID 58983617) has the molecular formula C35H28F12O7S2 and a molecular weight of 852.71 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[5-[4-[4-[2-(4-methoxyphenyl)propan-2-yl]phenoxy]phenyl]sulfonyl-2-methylphenyl]hexane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[5-[4-[4-[2-(4-methoxyphenyl)propan-2-yl]phenoxy]phenyl]sulfonyl-2-methylphenyl]hexane-1-sulfonic acid |
|---|---|
| PubChem CID | 58983617 |
| Molecular Formula | C35H28F12O7S2 |
| Molecular Weight | 852.71 g/mol |
| Exact Mass | 852.11 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[5-[4-[4-[2-(4-methoxyphenyl)propan-2-yl]phenoxy]phenyl]sulfonyl-2-methylphenyl]hexane-1-sulfonic acid |
| SMILES | COc1ccc(C(C)(C)c2ccc(Oc3ccc(S(=O)(=O)c4ccc(C)c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H28F12O7S2/c1-20-5-16-27(19-28(20)30(36,37)31(38,39)32(40,41)33(42,43)34(44,45)35(46,47)56(50,51)52)55(48,49)26-17-14-25(15-18-26)54-24-12-8-22(9-13-24)29(2,3)21-6-10-23(53-4)11-7-21/h5-19H,1-4H3,(H,50,51,52) |
| InChIKey | FIAGYRUSDPWLJJ-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.71 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|