C31H20F12O6S — CID 58983621
1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[5-[4-(6-methoxynaphthalen-2-yl)oxybenzoyl]-2-methylphenyl]hexane-1-sulfonic acid (PubChem CID 58983621) has the molecular formula C31H20F12O6S and a molecular weight of 748.54 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[5-[4-(6-methoxynaphthalen-2-yl)oxybenzoyl]-2-methylphenyl]hexane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[5-[4-(6-methoxynaphthalen-2-yl)oxybenzoyl]-2-methylphenyl]hexane-1-sulfonic acid |
|---|---|
| PubChem CID | 58983621 |
| Molecular Formula | C31H20F12O6S |
| Molecular Weight | 748.54 g/mol |
| Exact Mass | 748.08 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[5-[4-(6-methoxynaphthalen-2-yl)oxybenzoyl]-2-methylphenyl]hexane-1-sulfonic acid |
| SMILES | COc1ccc2cc(Oc3ccc(C(=O)c4ccc(C)c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)c4)cc3)ccc2c1 |
| InChI | InChI=1S/C31H20F12O6S/c1-16-3-4-20(25(44)17-5-9-21(10-6-17)49-23-12-8-18-13-22(48-2)11-7-19(18)14-23)15-24(16)26(32,33)27(34,35)28(36,37)29(38,39)30(40,41)31(42,43)50(45,46)47/h3-15H,1-2H3,(H,45,46,47) |
| InChIKey | IMSBENCBKXJQQW-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.54 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|