C43H32F8O8S2 — CID 58983630
1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[5-[4-[4-[(4-methoxyphenyl)-diphenylmethyl]phenoxy]phenyl]sulfonyl-2-methylphenyl]ethoxy]ethanesulfonic acid (PubChem CID 58983630) has the molecular formula C43H32F8O8S2 and a molecular weight of 892.84 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[5-[4-[4-[(4-methoxyphenyl)-diphenylmethyl]phenoxy]phenyl]sulfonyl-2-methylphenyl]ethoxy]ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[5-[4-[4-[(4-methoxyphenyl)-diphenylmethyl]phenoxy]phenyl]sulfonyl-2-methylphenyl]ethoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 58983630 |
| Molecular Formula | C43H32F8O8S2 |
| Molecular Weight | 892.84 g/mol |
| Exact Mass | 892.14 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[5-[4-[4-[(4-methoxyphenyl)-diphenylmethyl]phenoxy]phenyl]sulfonyl-2-methylphenyl]ethoxy]ethanesulfonic acid |
| SMILES | COc1ccc(C(c2ccccc2)(c2ccccc2)c2ccc(Oc3ccc(S(=O)(=O)c4ccc(C)c(C(F)(F)C(F)(F)OC(F)(F)C(F)(F)S(=O)(=O)O)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C43H32F8O8S2/c1-28-13-24-37(27-38(28)40(44,45)41(46,47)59-42(48,49)43(50,51)61(54,55)56)60(52,53)36-25-22-35(23-26-36)58-34-20-16-32(17-21-34)39(29-9-5-3-6-10-29,30-11-7-4-8-12-30)31-14-18-33(57-2)19-15-31/h3-27H,1-2H3,(H,54,55,56) |
| InChIKey | FNTQNGVRLAPTHV-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.84 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|