C36H24F12O7S2 — CID 58983637
1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[5-[4-[4-(4-methoxyphenyl)phenoxy]naphthalen-1-yl]sulfonyl-2-methylphenyl]hexane-1-sulfonic acid (PubChem CID 58983637) has the molecular formula C36H24F12O7S2 and a molecular weight of 860.69 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[5-[4-[4-(4-methoxyphenyl)phenoxy]naphthalen-1-yl]sulfonyl-2-methylphenyl]hexane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[5-[4-[4-(4-methoxyphenyl)phenoxy]naphthalen-1-yl]sulfonyl-2-methylphenyl]hexane-1-sulfonic acid |
|---|---|
| PubChem CID | 58983637 |
| Molecular Formula | C36H24F12O7S2 |
| Molecular Weight | 860.69 g/mol |
| Exact Mass | 860.08 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[5-[4-[4-(4-methoxyphenyl)phenoxy]naphthalen-1-yl]sulfonyl-2-methylphenyl]hexane-1-sulfonic acid |
| SMILES | COc1ccc(-c2ccc(Oc3ccc(S(=O)(=O)c4ccc(C)c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)c4)c4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C36H24F12O7S2/c1-20-7-16-25(19-28(20)31(37,38)32(39,40)33(41,42)34(43,44)35(45,46)36(47,48)57(51,52)53)56(49,50)30-18-17-29(26-5-3-4-6-27(26)30)55-24-14-10-22(11-15-24)21-8-12-23(54-2)13-9-21/h3-19H,1-2H3,(H,51,52,53) |
| InChIKey | UXMUUGRAXKGKCU-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.69 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|