C39H26F12O6S — CID 58983643
1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[5-[4-[4-[4-(4-methoxyphenyl)phenyl]phenoxy]benzoyl]-2-methylphenyl]hexane-1-sulfonic acid (PubChem CID 58983643) has the molecular formula C39H26F12O6S and a molecular weight of 850.67 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[5-[4-[4-[4-(4-methoxyphenyl)phenyl]phenoxy]benzoyl]-2-methylphenyl]hexane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[5-[4-[4-[4-(4-methoxyphenyl)phenyl]phenoxy]benzoyl]-2-methylphenyl]hexane-1-sulfonic acid |
|---|---|
| PubChem CID | 58983643 |
| Molecular Formula | C39H26F12O6S |
| Molecular Weight | 850.67 g/mol |
| Exact Mass | 850.13 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[5-[4-[4-[4-(4-methoxyphenyl)phenyl]phenoxy]benzoyl]-2-methylphenyl]hexane-1-sulfonic acid |
| SMILES | COc1ccc(-c2ccc(-c3ccc(Oc4ccc(C(=O)c5ccc(C)c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)c5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H26F12O6S/c1-22-3-4-28(21-32(22)34(40,41)35(42,43)36(44,45)37(46,47)38(48,49)39(50,51)58(53,54)55)33(52)27-13-19-31(20-14-27)57-30-17-11-26(12-18-30)24-7-5-23(6-8-24)25-9-15-29(56-2)16-10-25/h3-21H,1-2H3,(H,53,54,55) |
| InChIKey | RAJYCHSPMGUTNT-UHFFFAOYSA-N |
| XLogP | 11.47 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.67 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|