C34H30F8O9S2 — CID 58983652
1,1,2,2,3,3,4,4-octafluoro-4-[5-[4-[2-(2-methoxyethoxy)-4-(4-methoxy-3-methylphenyl)phenoxy]phenyl]sulfonyl-2-methylphenyl]butane-1-sulfonic acid (PubChem CID 58983652) has the molecular formula C34H30F8O9S2 and a molecular weight of 798.72 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluoro-4-[5-[4-[2-(2-methoxyethoxy)-4-(4-methoxy-3-methylphenyl)phenoxy]phenyl]sulfonyl-2-methylphenyl]butane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3,4,4-octafluoro-4-[5-[4-[2-(2-methoxyethoxy)-4-(4-methoxy-3-methylphenyl)phenoxy]phenyl]sulfonyl-2-methylphenyl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 58983652 |
| Molecular Formula | C34H30F8O9S2 |
| Molecular Weight | 798.72 g/mol |
| Exact Mass | 798.12 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluoro-4-[5-[4-[2-(2-methoxyethoxy)-4-(4-methoxy-3-methylphenyl)phenoxy]phenyl]sulfonyl-2-methylphenyl]butane-1-sulfonic acid |
| SMILES | COCCOc1cc(-c2ccc(OC)c(C)c2)ccc1Oc1ccc(S(=O)(=O)c2ccc(C)c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C34H30F8O9S2/c1-20-5-10-26(19-27(20)31(35,36)32(37,38)33(39,40)34(41,42)53(45,46)47)52(43,44)25-11-8-24(9-12-25)51-29-14-7-23(18-30(29)50-16-15-48-3)22-6-13-28(49-4)21(2)17-22/h5-14,17-19H,15-16H2,1-4H3,(H,45,46,47) |
| InChIKey | XVUGTADCGWQNSW-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.72 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|