C35H57NO6SSi — CID 58983923
trimethyl-[3-[3-[5-(2,2,6,6-tetramethylpiperidin-1-yl)oxy-4-[3-[3-(trioxidanylsulfanyl)propoxy]phenyl]pentan-2-yl]phenoxy]propyl]silane (PubChem CID 58983923) has the molecular formula C35H57NO6SSi and a molecular weight of 647.99 g/mol. Its IUPAC name is trimethyl-[3-[3-[5-(2,2,6,6-tetramethylpiperidin-1-yl)oxy-4-[3-[3-(trioxidanylsulfanyl)propoxy]phenyl]pentan-2-yl]phenoxy]propyl]silane.
| Compound Name | trimethyl-[3-[3-[5-(2,2,6,6-tetramethylpiperidin-1-yl)oxy-4-[3-[3-(trioxidanylsulfanyl)propoxy]phenyl]pentan-2-yl]phenoxy]propyl]silane |
|---|---|
| PubChem CID | 58983923 |
| Molecular Formula | C35H57NO6SSi |
| Molecular Weight | 647.99 g/mol |
| Exact Mass | 647.37 |
| IUPAC Name | trimethyl-[3-[3-[5-(2,2,6,6-tetramethylpiperidin-1-yl)oxy-4-[3-[3-(trioxidanylsulfanyl)propoxy]phenyl]pentan-2-yl]phenoxy]propyl]silane |
| SMILES | CC(CC(CON1C(C)(C)CCCC1(C)C)c1cccc(OCCCSOOO)c1)c1cccc(OCCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C35H57NO6SSi/c1-28(29-14-9-16-32(25-29)39-21-13-23-44(6,7)8)24-31(27-40-36-34(2,3)18-11-19-35(36,4)5)30-15-10-17-33(26-30)38-20-12-22-43-42-41-37/h9-10,14-17,25-26,28,31,37H,11-13,18-24,27H2,1-8H3 |
| InChIKey | CJNRIBKKBIQNFK-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.99 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|