About (dimethylamino)methyl 2-cyanoprop-2-enoate
(dimethylamino)methyl 2-cyanoprop-2-enoate (PubChem CID 58984023) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is (dimethylamino)methyl 2-cyanoprop-2-enoate.
Molecular Properties
| Compound Name | (dimethylamino)methyl 2-cyanoprop-2-enoate |
| PubChem CID | 58984023 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | (dimethylamino)methyl 2-cyanoprop-2-enoate |
| SMILES | C=C(C#N)C(=O)OCN(C)C |
| InChI | InChI=1S/C7H10N2O2/c1-6(4-8)7(10)11-5-9(2)3/h1,5H2,2-3H3 |
| InChIKey | IVEHMXXPXUKUFL-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (dimethylamino)methyl 2-cyanoprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (dimethylamino)methyl 2-cyanoprop-2-enoate?
The IUPAC name of (dimethylamino)methyl 2-cyanoprop-2-enoate (CID 58984023) is (dimethylamino)methyl 2-cyanoprop-2-enoate.
What is the SMILES notation for (dimethylamino)methyl 2-cyanoprop-2-enoate?
The canonical SMILES for (dimethylamino)methyl 2-cyanoprop-2-enoate is C=C(C#N)C(=O)OCN(C)C.
What is the InChIKey of (dimethylamino)methyl 2-cyanoprop-2-enoate?
The InChIKey is IVEHMXXPXUKUFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-6(4-8)7(10)11-5-9(2)3/h1,5H2,2-3H3.
What are the key properties of (dimethylamino)methyl 2-cyanoprop-2-enoate?
(dimethylamino)methyl 2-cyanoprop-2-enoate has a molecular weight of 154.17 g/mol, XLogP of 0.13, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (dimethylamino)methyl 2-cyanoprop-2-enoate is sourced from PubChem (CID 58984023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).