About N,N-bis(3,5-ditert-butylphenyl)hydroxylamine
N,N-bis(3,5-ditert-butylphenyl)hydroxylamine (PubChem CID 58984158) has the molecular formula C28H43NO
and a molecular weight of 409.66 g/mol. Its IUPAC name is N,N-bis(3,5-ditert-butylphenyl)hydroxylamine.
Molecular Properties
| Compound Name | N,N-bis(3,5-ditert-butylphenyl)hydroxylamine |
| PubChem CID | 58984158 |
| Molecular Formula | C28H43NO |
| Molecular Weight | 409.66 g/mol |
| Exact Mass | 409.33 |
| IUPAC Name | N,N-bis(3,5-ditert-butylphenyl)hydroxylamine |
| SMILES | CC(C)(C)c1cc(N(O)c2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H43NO/c1-25(2,3)19-13-20(26(4,5)6)16-23(15-19)29(30)24-17-21(27(7,8)9)14-22(18-24)28(10,11)12/h13-18,30H,1-12H3 |
| InChIKey | PVAHPFPXVFASLY-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.66 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-bis(3,5-ditert-butylphenyl)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(3,5-ditert-butylphenyl)hydroxylamine?
The IUPAC name of N,N-bis(3,5-ditert-butylphenyl)hydroxylamine (CID 58984158) is N,N-bis(3,5-ditert-butylphenyl)hydroxylamine.
What is the SMILES notation for N,N-bis(3,5-ditert-butylphenyl)hydroxylamine?
The canonical SMILES for N,N-bis(3,5-ditert-butylphenyl)hydroxylamine is CC(C)(C)c1cc(N(O)c2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(C(C)(C)C)c1.
What is the InChIKey of N,N-bis(3,5-ditert-butylphenyl)hydroxylamine?
The InChIKey is PVAHPFPXVFASLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H43NO/c1-25(2,3)19-13-20(26(4,5)6)16-23(15-19)29(30)24-17-21(27(7,8)9)14-22(18-24)28(10,11)12/h13-18,30H,1-12H3.
What are the key properties of N,N-bis(3,5-ditert-butylphenyl)hydroxylamine?
N,N-bis(3,5-ditert-butylphenyl)hydroxylamine has a molecular weight of 409.66 g/mol, XLogP of 8.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(3,5-ditert-butylphenyl)hydroxylamine is sourced from PubChem (CID 58984158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).