C31H29ClN4O7S2 — CID 58984209
[5-chloro-6-cyano-3-ethyl-2-[3-[5-phenyl-3-(4-sulfobutyl)-1,3-benzoxazol-3-ium-2-yl]prop-2-enylidene]benzimidazol-1-yl]methanesulfonate (PubChem CID 58984209) has the molecular formula C31H29ClN4O7S2 and a molecular weight of 669.18 g/mol. Its IUPAC name is [5-chloro-6-cyano-3-ethyl-2-[3-[5-phenyl-3-(4-sulfobutyl)-1,3-benzoxazol-3-ium-2-yl]prop-2-enylidene]benzimidazol-1-yl]methanesulfonate.
| Compound Name | [5-chloro-6-cyano-3-ethyl-2-[3-[5-phenyl-3-(4-sulfobutyl)-1,3-benzoxazol-3-ium-2-yl]prop-2-enylidene]benzimidazol-1-yl]methanesulfonate |
|---|---|
| PubChem CID | 58984209 |
| Molecular Formula | C31H29ClN4O7S2 |
| Molecular Weight | 669.18 g/mol |
| Exact Mass | 668.12 |
| IUPAC Name | [5-chloro-6-cyano-3-ethyl-2-[3-[5-phenyl-3-(4-sulfobutyl)-1,3-benzoxazol-3-ium-2-yl]prop-2-enylidene]benzimidazol-1-yl]methanesulfonate |
| SMILES | CCN1C(=CC=Cc2oc3ccc(-c4ccccc4)cc3[n+]2CCCCS(=O)(=O)O)N(CS(=O)(=O)[O-])c2cc(C#N)c(Cl)cc21 |
| InChI | InChI=1S/C31H29ClN4O7S2/c1-2-34-27-19-25(32)24(20-33)18-26(27)36(21-45(40,41)42)30(34)11-8-12-31-35(15-6-7-16-44(37,38)39)28-17-23(13-14-29(28)43-31)22-9-4-3-5-10-22/h3-5,8-14,17-19H,2,6-7,15-16,21H2,1H3,(H-,37,38,39,40,41,42) |
| InChIKey | UKNKYUHBHWNSLM-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 158.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.18 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|