C27H24ClN5O5 — CID 58984673
2-[4-[4-(benzotriazol-1-ylmethyl)-3-oxo-2,5-dihydro-1,4-benzodiazepine-1-carbonyl]-3-chlorophenoxy]ethyl acetate (PubChem CID 58984673) has the molecular formula C27H24ClN5O5 and a molecular weight of 533.97 g/mol. Its IUPAC name is 2-[4-[4-(benzotriazol-1-ylmethyl)-3-oxo-2,5-dihydro-1,4-benzodiazepine-1-carbonyl]-3-chlorophenoxy]ethyl acetate.
| Compound Name | 2-[4-[4-(benzotriazol-1-ylmethyl)-3-oxo-2,5-dihydro-1,4-benzodiazepine-1-carbonyl]-3-chlorophenoxy]ethyl acetate |
|---|---|
| PubChem CID | 58984673 |
| Molecular Formula | C27H24ClN5O5 |
| Molecular Weight | 533.97 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | 2-[4-[4-(benzotriazol-1-ylmethyl)-3-oxo-2,5-dihydro-1,4-benzodiazepine-1-carbonyl]-3-chlorophenoxy]ethyl acetate |
| SMILES | CC(=O)OCCOc1ccc(C(=O)N2CC(=O)N(Cn3nnc4ccccc43)Cc3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C27H24ClN5O5/c1-18(34)37-12-13-38-20-10-11-21(22(28)14-20)27(36)32-16-26(35)31(15-19-6-2-4-8-24(19)32)17-33-25-9-5-3-7-23(25)29-30-33/h2-11,14H,12-13,15-17H2,1H3 |
| InChIKey | PPTDNMQOBRUZFV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 106.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.97 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|