C11H14N2O — CID 58984785
(2S)-2,4-dimethyl-2,5-dihydro-1H-1,4-benzodiazepin-3-one (PubChem CID 58984785) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is (2S)-2,4-dimethyl-2,5-dihydro-1H-1,4-benzodiazepin-3-one.
| Compound Name | (2S)-2,4-dimethyl-2,5-dihydro-1H-1,4-benzodiazepin-3-one |
|---|---|
| PubChem CID | 58984785 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | (2S)-2,4-dimethyl-2,5-dihydro-1H-1,4-benzodiazepin-3-one |
| SMILES | C[C@@H]1Nc2ccccc2CN(C)C1=O |
| InChI | InChI=1S/C11H14N2O/c1-8-11(14)13(2)7-9-5-3-4-6-10(9)12-8/h3-6,8,12H,7H2,1-2H3/t8-/m0/s1 |
| InChIKey | QAZZSCPBEYSMLW-QMMMGPOBSA-N |
| XLogP | 1.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |